CAS 117423-74-2
:3-{[3-(2-carboxyethyl)-4-{[(5E)-6-(4-methoxyphenyl)hex-5-en-1-yl]oxy}phenyl]carbonyl}benzoic acid
Description:
The chemical substance known as 3-{[3-(2-carboxyethyl)-4-{[(5E)-6-(4-methoxyphenyl)hex-5-en-1-yl]oxy}phenyl]carbonyl}benzoic acid, with the CAS number 117423-74-2, is a complex organic compound characterized by its multi-functional structure. It features multiple aromatic rings, which contribute to its potential as a bioactive molecule. The presence of carboxylic acid groups indicates acidic properties, while the methoxy and ethyl substituents suggest potential for solubility in organic solvents and interactions with biological systems. The compound's structure includes a hexenyl moiety, which may impart unique reactivity and stability characteristics. Its potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its biological activity and chemical behavior. The intricate arrangement of functional groups allows for diverse interactions, making it a subject of interest in medicinal chemistry and related fields. Further studies would be necessary to elucidate its specific properties, reactivity, and potential applications in various domains.
Formula:C30H30O7
InChI:InChI=1/C30H30O7/c1-36-26-14-10-21(11-15-26)7-4-2-3-5-18-37-27-16-12-24(19-22(27)13-17-28(31)32)29(33)23-8-6-9-25(20-23)30(34)35/h4,6-12,14-16,19-20H,2-3,5,13,17-18H2,1H3,(H,31,32)(H,34,35)/b7-4+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenepropanoic acid, 5-(3-carboxybenzoyl)-2-[[(5E)-6-(4-methoxyphenyl)-5-hexen-1-yl]oxy]-
CAS:Formula:C30H30O7Purity:98%Color and Shape:SolidMolecular weight:502.5550LY223982
CAS:LY223982 is an effective and specific inhibitor of the leukotriene B4 receptor (IC50: 13.2 nM). It also can against [3H]LTB4 binding to LTB4 receptor.Formula:C30H30O7Purity:99.86%Color and Shape:SolidMolecular weight:502.56LY223982
CAS:LY223982 is a covalent linkage-forming compound that inhibits the activity of serine proteases. It has been shown to inhibit the protease activity of cytosolic calcium-dependent, chemotactic factors and other compounds in experimental models of infectious diseases such as tuberculosis and AIDS. LY223982 binds to and inhibits the catalytic site of serine proteases such as trypsin, chymotrypsin, elastase, cathepsin G, proteinase 3 and urokinase-type plasminogen activator. This drug is also an inhibitor of activated adhesion molecules that are involved in inflammatory processes.Formula:C30H30O7Purity:Min. 95%Molecular weight:502.56 g/mol



