
CAS 1174231-21-0
:5-[2-(Phenylmethoxy)ethoxy]-2-pyrazinecarboxylic acid
Description:
5-[2-(Phenylmethoxy)ethoxy]-2-pyrazinecarboxylic acid is a chemical compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the phenylmethoxy and ethoxy substituents enhances its lipophilicity, which may influence its solubility and biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazine moiety, which is often associated with various biological activities. Additionally, the compound may exhibit interesting properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would require empirical investigation. Its CAS number, 1174231-21-0, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound represents a unique structure that could be of interest in various fields, including organic synthesis and drug discovery.
Formula:C14H14N2O4
InChI:InChI=1S/C14H14N2O4/c17-14(18)12-8-16-13(9-15-12)20-7-6-19-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H,17,18)
InChI key:InChIKey=TUQANWMDVJRNNK-UHFFFAOYSA-N
SMILES:O(CCOCC1=CC=CC=C1)C=2C=NC(C(O)=O)=CN2
Synonyms:- 2-Pyrazinecarboxylic acid, 5-[2-(phenylmethoxy)ethoxy]-
- 5-(2-Benzyloxyethoxy)pyrazine-2-carboxylic acid
- 5-[2-(Phenylmethoxy)ethoxy]-2-pyrazinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.