
CAS 1174312-54-9
:B-[6-[(1,1-Dimethylethoxy)methyl]-3-pyridinyl]boronic acid
Description:
B-[6-[(1,1-Dimethylethoxy)methyl]-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical applications, including drug development and organic synthesis. The compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the 1,1-dimethylethoxy group enhances its solubility and stability, making it suitable for use in various solvents. This compound may exhibit unique reactivity due to the combination of the boronic acid and pyridine functionalities, allowing it to participate in cross-coupling reactions, a key process in the synthesis of complex organic molecules. Additionally, boronic acids are often utilized in medicinal chemistry for their ability to interact with biological targets, suggesting potential applications in pharmaceuticals. Overall, this compound's structural features position it as a versatile reagent in both synthetic and medicinal chemistry contexts.
Formula:C10H16BNO3
InChI:InChI=1S/C10H16BNO3/c1-10(2,3)15-7-9-5-4-8(6-12-9)11(13)14/h4-6,13-14H,7H2,1-3H3
InChI key:InChIKey=POLLWYMFAZQGDH-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)C1=CC=C(B(O)O)C=N1
Synonyms:- [6-[(tert-Butoxy)methyl]pyridin-3-yl]boronic acid
- B-[6-[(1,1-Dimethylethoxy)methyl]-3-pyridinyl]boronic acid
- Boronic acid, B-[6-[(1,1-dimethylethoxy)methyl]-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
