
CAS 1174320-99-0
:2-Pyrazinecarboxylic acid, 5-(difluoromethoxy)-, methyl ester
Description:
2-Pyrazinecarboxylic acid, 5-(difluoromethoxy)-, methyl ester is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The presence of a difluoromethoxy group at the 5-position of the pyrazine ring introduces significant electronegative characteristics, influencing the compound's reactivity and solubility. Generally, compounds with such functional groups exhibit polar characteristics, which can enhance their solubility in polar solvents. The presence of fluorine atoms often contributes to unique biological activities and can affect the compound's pharmacokinetics. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. As with many pyrazine derivatives, it may exhibit various biological activities, making it a candidate for further investigation in drug discovery and development.
Formula:C7H6F2N2O3
InChI:InChI=1S/C7H6F2N2O3/c1-13-6(12)4-2-11-5(3-10-4)14-7(8)9/h2-3,7H,1H3
InChI key:InChIKey=YEEMMYASWWDLTP-UHFFFAOYSA-N
SMILES:O(C(F)F)C=1C=NC(C(OC)=O)=CN1
Synonyms:- 2-Pyrazinecarboxylic acid, 5-(difluoromethoxy)-, methyl ester
- methyl 5-difluoromethoxypyrazine-2-carboxylate
- 5-(Difluoromethoxy)pyrazine-2-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.