CymitQuimica logo

CAS 1174321-06-2

:

5-(difluoromethyl)pyrazine-2-carboxylic acid

Description:
5-(Difluoromethyl)pyrazine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The compound features a difluoromethyl group (-CF2H) and a carboxylic acid group (-COOH) attached to the pyrazine ring, contributing to its chemical reactivity and potential applications. The difluoromethyl group can enhance the lipophilicity and biological activity of the molecule, making it of interest in medicinal chemistry. The carboxylic acid functionality provides acidic properties, allowing for potential interactions in various chemical environments. This compound may exhibit interesting properties such as solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the carboxylic acid group. Its unique structure and functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific reactivity and stability would depend on the surrounding conditions and the presence of other functional groups in a given reaction context.
Formula:C6H4F2N2O2
InChI:InChI=1S/C6H4F2N2O2/c7-5(8)3-1-10-4(2-9-3)6(11)12/h1-2,5H,(H,11,12)
InChI key:UYWJPTNAOQSWOS-UHFFFAOYSA-N
SMILES:C1=C(N=CC(=N1)C(=O)O)C(F)F
Synonyms:
  • 5-Difluoromethylpyrazine-2-carboxylic acid
  • 5-(trifluoroMethyl)pyrazine-2-carboxylic acid
  • 2-Pyrazinecarboxylic acid, 5-(difluoromethyl)-
  • 180624
Found 4 products.