CAS 117436-83-6

4,5,6,7-Tetrahydro-3-hydroxy-1(3H)-isobenzofuranone

Description:

4,5,6,7-Tetrahydro-3-hydroxy-1(3H)-isobenzofuranone, with the CAS number 117436-83-6, is a chemical compound characterized by its bicyclic structure, which includes a fused isobenzofuran moiety. This compound features a tetrahydrofuran ring that contributes to its cyclic nature, along with a hydroxyl group that enhances its reactivity and solubility in polar solvents. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its physical properties, such as boiling point and solubility. This compound may exhibit biological activity, making it of interest in medicinal chemistry and organic synthesis. Its unique structure allows for various functionalization possibilities, which can be explored for applications in pharmaceuticals or agrochemicals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₈H₁₀O₃

InChI: InChI=1S/C8H10O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h7,9H,1-4H2

InChI key: InChIKey=IQGNSMPKOZXGDM-UHFFFAOYSA-N

SMILES: OC1C2=C(C(=O)O1)CCCC2

Synonyms:

• 3-Hydroxy-4,5,6,7-tetrahydro-2-benzofuran-1(3H)-one
• 4,5,6,7-Tetrahydro-3-hydroxy-1(3H)-isobenzofuranone
• 1(3H)-Isobenzofuranone, 4,5,6,7-tetrahydro-3-hydroxy-