CymitQuimica logo

CAS 117449-74-8

:

2,5-Dichloro-6-methyl-3-pyridinecarboxylic acid

Description:
2,5-Dichloro-6-methyl-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two chlorine substituents at the 2 and 5 positions and a methyl group at the 6 position of the pyridine ring, along with a carboxylic acid functional group at the 3 position. The presence of chlorine atoms contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. The carboxylic acid group imparts acidic characteristics, making it capable of participating in various chemical reactions, including esterification and neutralization. This compound may be utilized in pharmaceutical synthesis or as an intermediate in organic synthesis due to its functional groups. Additionally, its structural features suggest potential applications in agrochemicals or as a building block in the development of more complex molecules. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.
Formula:C7H5Cl2NO2
InChI:InChI=1S/C7H5Cl2NO2/c1-3-5(8)2-4(7(11)12)6(9)10-3/h2H,1H3,(H,11,12)
InChI key:InChIKey=VGUJAYWJJRUFKB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)N=C(C)C(Cl)=C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 2,5-dichloro-6-methyl-
  • 2,5-Dichloro-6-methyl-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.