CAS 1174534-46-3

2(1H)-Pyridinone, 6-amino-, hydrochloride (1:1)

Description:

2(1H)-Pyridinone, 6-amino-, hydrochloride (1:1) is a chemical compound characterized by its pyridinone structure, which features a pyridine ring with a keto group and an amino group at the 6-position. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the amino group suggests potential basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its hydrochloride form indicates that it is a salt formed from the reaction of the base with hydrochloric acid, which can influence its pharmacological properties. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.

Formula: C₅H₆N₂O·ClH

InChI: InChI=1S/C5H6N2O.ClH/c6-4-2-1-3-5(8)7-4;/h1-3H,(H3,6,7,8);1H

InChI key: InChIKey=RGJFRVCCKTVUJU-UHFFFAOYSA-N

SMILES: NC=1NC(=O)C=CC1.Cl

Synonyms:

• 2(1H)-Pyridinone, 6-amino-, hydrochloride (1:1)