CymitQuimica logo

CAS 1174579-88-4

:

2,4-Dihydro-4-methyl-5-(4-pyrimidinyl)-3H-1,2,4-triazole-3-thione

Description:
2,4-Dihydro-4-methyl-5-(4-pyrimidinyl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole and pyrimidine moieties, which contribute to its biological activity. This substance typically exhibits a thione functional group, indicating the presence of sulfur in its structure, which can influence its reactivity and interaction with biological targets. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, due to the presence of the triazole ring, which is known for its ability to inhibit certain enzymes in pathogens. Additionally, the methyl and pyrimidinyl substituents can enhance its lipophilicity and bioavailability. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it important to consider these factors in practical applications. Overall, 2,4-Dihydro-4-methyl-5-(4-pyrimidinyl)-3H-1,2,4-triazole-3-thione represents a class of compounds with significant potential in medicinal chemistry.
Formula:C7H7N5S
InChI:InChI=1S/C7H7N5S/c1-12-6(10-11-7(12)13)5-2-3-8-4-9-5/h2-4H,1H3,(H,11,13)
InChI key:InChIKey=UGAAPUNICPHXBM-UHFFFAOYSA-N
SMILES:CN1C(=NNC1=S)C=2C=CN=CN2
Synonyms:
  • 2,4-Dihydro-4-methyl-5-(4-pyrimidinyl)-3H-1,2,4-triazole-3-thione
  • 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-methyl-5-(4-pyrimidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.