CAS 1174835-55-2

7-(1,5-Dimethyl-1H-pyrazol-4-yl)[1,2,4]triazolo[1,5-a]pyrimidine-2-acetic acid

Description:

7-(1,5-Dimethyl-1H-pyrazol-4-yl)[1,2,4]triazolo[1,5-a]pyrimidine-2-acetic acid is a chemical compound characterized by its complex heterocyclic structure, which includes both pyrazole and triazole rings fused to a pyrimidine core. This compound typically exhibits properties associated with heterocycles, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the acetic acid functional group suggests it may have acidic properties, influencing its solubility and reactivity. The dimethyl substitution on the pyrazole ring can affect its electronic properties and steric hindrance, potentially impacting its interaction with biological targets. As a compound with a specific CAS number, it can be identified in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Its synthesis and characterization would involve standard organic chemistry techniques, and its potential applications could include roles as a pharmaceutical agent or a research tool in studying biological pathways.

Formula: C₁₂H₁₂N₆O₂

InChI: InChI=1S/C12H12N6O2/c1-7-8(6-14-17(7)2)9-3-4-13-12-15-10(5-11(19)20)16-18(9)12/h3-4,6H,5H2,1-2H3,(H,19,20)

InChI key: InChIKey=QOTLNKGYLKNROX-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=NN2C(=CC=NC2=N1)C3=C(C)N(C)N=C3

Synonyms:

• 7-(1,5-Dimethyl-1H-pyrazol-4-yl)[1,2,4]triazolo[1,5-a]pyrimidine-2-acetic acid
• [1,2,4]Triazolo[1,5-a]pyrimidine-2-acetic acid, 7-(1,5-dimethyl-1H-pyrazol-4-yl)-

2-[7-(1,5-Dimethyl-1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetic acid

CAS: 1174835-55-2

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₆O₂

Purity: Min. 95%

Molecular weight: 272.26 g/mol

Ref: 3D-ZWB83555