CAS 1174906-84-3
:5-Chloro-2-methylbenzenecarbothioamide
Description:
5-Chloro-2-methylbenzenecarbothioamide is an organic compound characterized by the presence of a chloro group and a methyl group attached to a benzene ring, along with a carbothioamide functional group. Its molecular structure features a thiocarbonyl group (C=S) linked to an amine (NH2), which contributes to its reactivity and potential biological activity. The chloro substituent introduces electronegativity, influencing the compound's polarity and solubility in various solvents. The methyl group can affect steric hindrance and the overall stability of the molecule. This compound may exhibit properties typical of thioureas, such as potential antimicrobial or antifungal activities, making it of interest in pharmaceutical research. Additionally, its unique structure may allow for various synthetic applications in organic chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C8H8ClNS
InChI:InChI=1S/C8H8ClNS/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H2,10,11)
InChI key:InChIKey=VRBFZACOOIIEFG-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=C(C)C=CC(Cl)=C1
Synonyms:- 5-Chloro-2-methylbenzenecarbothioamide
- Benzenecarbothioamide, 5-chloro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

