CAS 117506-56-6

Pyridinium, 1-[3-(acetylamino)phenyl]-, chloride (1:1)

Description:

Pyridinium, 1-[3-(acetylamino)phenyl]-, chloride (1:1), with the CAS number 117506-56-6, is a quaternary ammonium compound characterized by its pyridinium ring structure, which contributes to its aromatic properties and potential biological activity. The presence of the acetylamino group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. As a chloride salt, it is typically encountered in a solid form and is soluble in water, making it useful in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit properties such as antimicrobial activity or serve as a precursor in the synthesis of more complex molecules. Its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application. Overall, this compound represents a class of substances that can be utilized in medicinal chemistry and materials science due to its unique structural features and functional groups.

Formula: C₁₃H₁₃N₂O·Cl

InChI: InChI=1S/C13H12N2O.ClH/c1-11(16)14-12-6-5-7-13(10-12)15-8-3-2-4-9-15;/h2-10H,1H3;1H

InChI key: InChIKey=GURLEABUEHFPJH-UHFFFAOYSA-N

SMILES: N(C(C)=O)C=1C=C(C=CC1)[N+]=2C=CC=CC2.[Cl-]

Synonyms:

• 1-(3-Acetamidophenyl)-1λ5-pyridin-1-ylium chloride
• Pyridinium, 1-[3-(acetylamino)phenyl]-, chloride
• Pyridinium, 1-[3-(acetylamino)phenyl]-, chloride (1:1)