CAS 1175146-66-3

2-(2-Azidoethyl)-1-methylpyrrolidine

Description:

2-(2-Azidoethyl)-1-methylpyrrolidine is a chemical compound characterized by its azido and pyrrolidine functional groups. It features a pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle, and an azido group (-N3) that is known for its reactivity and potential applications in click chemistry. The presence of the azidoethyl substituent indicates that the compound has a two-carbon chain linking the azido group to the pyrrolidine nitrogen. This structure may impart unique properties, such as increased reactivity towards nucleophiles and potential use in organic synthesis or material science. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Safety considerations are important due to the azido group, which can be explosive under certain conditions. As with many nitrogen-containing compounds, it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry or related fields. Proper handling and storage are essential to mitigate risks associated with its reactivity.

Formula: C₇H₁₄N₄

InChI: InChI=1S/C7H14N4/c1-11-6-2-3-7(11)4-5-9-10-8/h7H,2-6H2,1H3

InChI key: InChIKey=FZYNZBZPJWEDHP-UHFFFAOYSA-N

SMILES: C(CN=[N+]=[N-])C1N(C)CCC1

Synonyms:

• Pyrrolidine, 2-(2-azidoethyl)-1-methyl-
• 2-(2-Azidoethyl)-1-methylpyrrolidine