CAS 1175146-86-7
:1-(1-Propyl-4-piperidinyl)-1H-1,2,3-triazole-4-carboxaldehyde
Description:
1-(1-Propyl-4-piperidinyl)-1H-1,2,3-triazole-4-carboxaldehyde is a chemical compound characterized by its unique structure, which includes a triazole ring and a piperidine moiety. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in pharmacological research. The triazole ring is known for its stability and ability to form hydrogen bonds, which can enhance the compound's solubility and bioavailability. Additionally, the propyl substituent on the piperidine may influence the compound's lipophilicity and overall pharmacokinetic properties. Overall, this compound's structural features suggest it may exhibit interesting biological activities, warranting further investigation in drug development and related fields.
Formula:C11H18N4O
InChI:InChI=1S/C11H18N4O/c1-2-5-14-6-3-11(4-7-14)15-8-10(9-16)12-13-15/h8-9,11H,2-7H2,1H3
InChI key:InChIKey=NOHHRMSIVFCWKC-UHFFFAOYSA-N
SMILES:C(=O)C1=CN(N=N1)C2CCN(CCC)CC2
Synonyms:- 1H-1,2,3-Triazole-4-carboxaldehyde, 1-(1-propyl-4-piperidinyl)-
- 1-(1-Propyl-4-piperidinyl)-1H-1,2,3-triazole-4-carboxaldehyde
- 1-(1-Propylpiperidin-4-yl)-1H-1,2,3-triazole-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.