CAS 117517-20-1
:3'-deoxy-3'-fluoroinosine
Description:
3'-Deoxy-3'-fluoroinosine is a modified nucleoside analog characterized by the presence of a fluorine atom at the 3' position of the ribose sugar moiety, replacing the hydroxyl group typically found in natural nucleosides. This modification imparts unique biochemical properties, making it of interest in various fields, including medicinal chemistry and molecular biology. The compound is known to exhibit antiviral activity, particularly against certain RNA viruses, by interfering with viral replication processes. Its structure allows it to mimic natural nucleosides, facilitating incorporation into RNA strands during synthesis. Additionally, the fluorine substitution can enhance the stability of the nucleoside against enzymatic degradation. The compound's potential applications extend to research in therapeutic agents and as a tool in studying nucleic acid metabolism. As with many nucleoside analogs, the pharmacokinetics, toxicity, and efficacy of 3'-deoxy-3'-fluoroinosine are subjects of ongoing research to fully understand its biological implications and therapeutic potential.
Formula:C10H11FN4O4
InChI:InChI=1/C10H11FN4O4/c11-5-4(1-16)19-10(7(5)17)15-3-14-6-8(15)12-2-13-9(6)18/h2-5,7,10,16-17H,1H2,(H,12,13,18)/t4-,5-,7-,10-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c2ncnc3O)O1)O)F)O
Synonyms:- Inosine, 3'-deoxy-3'-fluoro-
- 3'-Deoxy-3'-fluoroinosine
- 3'-F-Inosine
- 9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-9H-purin-6-ol
- Inosine, 3'-deoxy-3'-fluoro- (9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3'-Deoxy-3'-fluoroinosine
CAS:Nucleoside Derivatives - Fluoro-modified nucleosides, 3’-Modified nucleosidesFormula:C10H11FN4O4Color and Shape:SolidMolecular weight:270.223'-Deoxy-3'-fluoroinosine
CAS:3'-Deoxy-3'-fluoroinosine is a nucleoside analog that has been shown to have cytotoxic effects. It inhibits the growth of nematodes and other parasites by blocking the deacetylation of lipids in the cell membrane, which leads to their death. 3'-Deoxy-3'-fluoroinosine has also been shown to inhibit trypanosomiasis and leishmania infections by preventing the synthesis of purines and pyrimidines. This drug binds to 6-chloropurine ribonucleotide reductase, thereby inhibiting the production of nucleic acids. 3'-Deoxy-3'-fluoroinosine is not active against mammalian cells, which may be due to its inability to penetrate cell membranes efficiently.Purity:Min. 95%

