CymitQuimica logo

CAS 117523-91-8

:

N-[4-(Hydroxymethyl)-3-methylphenyl]acetamide

Description:
N-[4-(Hydroxymethyl)-3-methylphenyl]acetamide, with the CAS number 117523-91-8, is an organic compound characterized by its amide functional group. This substance features a phenyl ring substituted with a hydroxymethyl group and a methyl group, contributing to its unique chemical properties. The presence of the hydroxymethyl group enhances its solubility in polar solvents, while the methyl group can influence its steric and electronic characteristics. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, affecting its behavior in various chemical environments. Overall, N-[4-(Hydroxymethyl)-3-methylphenyl]acetamide represents a class of compounds that may have significant implications in medicinal chemistry and related fields.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-7-5-10(11-8(2)13)4-3-9(7)6-12/h3-5,12H,6H2,1-2H3,(H,11,13)
InChI key:InChIKey=LUGUYMHBKVWFQP-UHFFFAOYSA-N
SMILES:C(O)C1=C(C)C=C(NC(C)=O)C=C1
Synonyms:
  • N-[4-(Hydroxymethyl)-3-methylphenyl]acetamide
  • Acetamide, N-[4-(hydroxymethyl)-3-methylphenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.