CAS 1175278-06-4
:2-Iodo-5-methoxybenzothiazole
Description:
2-Iodo-5-methoxybenzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole core substituted with an iodine atom and a methoxy group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzothiazole moiety, which is known for its applications in pharmaceuticals and agrochemicals. The iodine substitution can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the methoxy group may contribute to the compound's solubility and stability. In terms of physical properties, compounds of this nature often have moderate melting points and may be soluble in organic solvents. The presence of halogens, such as iodine, can also affect the compound's spectral characteristics, making it detectable by various analytical techniques, including NMR and mass spectrometry. Overall, 2-Iodo-5-methoxybenzothiazole is of interest in synthetic chemistry and medicinal research due to its potential applications and unique chemical behavior.
Formula:C8H6INOS
InChI:InChI=1S/C8H6INOS/c1-11-5-2-3-7-6(4-5)10-8(9)12-7/h2-4H,1H3
InChI key:InChIKey=HSYKQDKTTDLAEX-UHFFFAOYSA-N
SMILES:IC=1SC=2C(=CC(OC)=CC2)N1
Synonyms:- 2-Iodo-5-methoxybenzo[d]thiazole
- Benzothiazole, 2-iodo-5-methoxy-
- 2-Iodo-5-methoxy-1,3-benzothiazole
- 2-Iodo-5-methoxybenzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
