
CAS 1175278-13-3
:7-Bromo-2-iodobenzothiazole
Description:
7-Bromo-2-iodobenzothiazole is a heterocyclic organic compound characterized by the presence of both bromine and iodine substituents on a benzothiazole ring system. This compound features a fused benzene and thiazole ring, which contributes to its unique chemical properties. The bromine and iodine atoms introduce significant electronegativity and steric effects, influencing its reactivity and interactions with other molecules. Typically, compounds like 7-bromo-2-iodobenzothiazole exhibit biological activity, making them of interest in medicinal chemistry and material science. They may serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. The presence of halogens can enhance the compound's lipophilicity and alter its solubility in various solvents. Additionally, the compound may exhibit fluorescence or other photophysical properties, which can be useful in imaging applications. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures are necessary. Overall, 7-bromo-2-iodobenzothiazole is a versatile compound with potential applications in various fields of research and industry.
Formula:C7H3BrINS
InChI:InChI=1S/C7H3BrINS/c8-4-2-1-3-5-6(4)11-7(9)10-5/h1-3H
InChI key:InChIKey=MDYKLCNDCHFYQP-UHFFFAOYSA-N
SMILES:BrC1=C2C(N=C(I)S2)=CC=C1
Synonyms:- 7-Bromo-2-iodobenzothiazole
- 7-Bromo-2-iodo-1,3-benzothiazole
- Benzothiazole, 7-bromo-2-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.