CAS 1175278-52-0

2-Chloro-4-benzothiazolecarbonitrile

Description:

2-Chloro-4-benzothiazolecarbonitrile is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a cyano group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chloro group enhances its reactivity, making it useful in synthetic organic chemistry. It is generally considered to have moderate to low solubility in water, while being more soluble in organic solvents. The compound may exhibit biological activity, which can be of interest in drug development or as a pesticide. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Proper storage conditions are essential to maintain its stability and prevent degradation. Overall, 2-Chloro-4-benzothiazolecarbonitrile is a versatile compound with significant relevance in chemical research and industrial applications.

Formula: C₈H₃ClN₂S

InChI: InChI=1S/C8H3ClN2S/c9-8-11-7-5(4-10)2-1-3-6(7)12-8/h1-3H

InChI key: InChIKey=HLUUWQHBUSRCAN-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(SC(Cl)=N2)=CC=C1

Synonyms:

• 2-Chloro-4-benzothiazolecarbonitrile
• 2-Chloro-1,3-benzothiazole-4-carbonitrile
• 4-Benzothiazolecarbonitrile, 2-chloro-