CAS 117539-59-0
:1-Bromo-5-(trifluoromethyl)naphthalene
Description:
1-Bromo-5-(trifluoromethyl)naphthalene is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to a naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused aromatic rings, contributing to its stability and hydrophobic nature. The bromine substituent enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The trifluoromethyl group is known for imparting unique electronic properties, increasing lipophilicity, and influencing the compound's overall polarity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other functional materials. Its physical properties, such as boiling point and solubility, are influenced by the presence of the bromine and trifluoromethyl groups, which can affect its interactions with solvents and other reagents. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C11H6BrF3
InChI:InChI=1S/C11H6BrF3/c12-10-6-2-3-7-8(10)4-1-5-9(7)11(13,14)15/h1-6H
InChI key:InChIKey=MMRSUDXSSYTCRV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(C(Br)=CC=C2)C=CC1
Synonyms:- 1-Bromo-5-(trifluoromethyl)naphthalene
- 1-Bromo-5-trifluoromethylnaphthalene
- Bromotrifluoromethylnaphthalene
- Naphthalene, 1-bromo-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.