CAS 117539-60-3
:1-Bromo-6-(trifluoromethyl)naphthalene
Description:
1-Bromo-6-(trifluoromethyl)naphthalene is an aromatic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to the naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused benzene rings, providing it with significant stability and hydrophobic properties. The bromine substituent introduces a polar functional group, enhancing its reactivity in nucleophilic substitution reactions. The trifluoromethyl group is known for its electron-withdrawing properties, which can influence the compound's reactivity and physical properties, such as boiling and melting points. Additionally, the presence of fluorine atoms can impart unique characteristics, such as increased lipophilicity and altered solubility in various solvents. 1-Bromo-6-(trifluoromethyl)naphthalene is often utilized in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions while maintaining the structural integrity of the naphthalene framework.
Formula:C11H6BrF3
InChI:InChI=1S/C11H6BrF3/c12-10-3-1-2-7-6-8(11(13,14)15)4-5-9(7)10/h1-6H
InChI key:InChIKey=SASWADBSZGOQTQ-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=C(C(F)(F)F)C=C2)C=CC1
Synonyms:- Naphthalene, 1-bromo-6-(trifluoromethyl)-
- 1-Bromo-6-(trifluoromethyl)naphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-Bromo-6-(trifluoromethyl)naphthalene
CAS:1-Bromo-6-(trifluoromethyl)naphthalene
Molecular weight:275.06455g/mol1-Bromo-6-trifluoromethyl-naphthalene
CAS:Controlled ProductApplications 1-Bromo-6-Trifluoromethyl-Naphthalene (cas# 117539-60-3) is a useful research chemical.
Formula:C11H6BrF3Color and Shape:NeatMolecular weight:275.065



