CAS 117552-79-1

Benzenesulfonic acid, 2,5-dihydroxy-, calcium salt, hydrate (2:1:2)

Description:

Benzenesulfonic acid, 2,5-dihydroxy-, calcium salt, hydrate (2:1:2), with CAS number 117552-79-1, is an organic compound characterized by its sulfonic acid group attached to a benzene ring, along with two hydroxyl groups at the 2 and 5 positions. This compound typically appears as a solid and is known for its solubility in water, which is influenced by the presence of the calcium salt and the hydrate form. The calcium salt form suggests that it may exhibit properties such as enhanced stability and reduced acidity compared to its free acid counterpart. Its structure allows for potential applications in various fields, including pharmaceuticals, agriculture, and as a surfactant or emulsifier in industrial processes. The presence of hydroxyl groups contributes to its reactivity and ability to form hydrogen bonds, which can enhance its solubility and interaction with other compounds. Overall, this compound is of interest due to its unique chemical properties and potential utility in diverse applications.

Formula: C₆H₆O₅SCa·H₂O

InChI: InChI=1S/C6H6O5S.Ca.H2O/c7-4-1-2-5(8)6(3-4)12(9,10)11;;/h1-3,7-8H,(H,9,10,11);;1H2

InChI key: InChIKey=IKGXRJWGFBNRAZ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=C(O)C=CC(O)=C1.[Ca].O

Synonyms:

• Benzenesulfonic acid, 2,5-dihydroxy-, calcium salt, hydrate (2:1:2)
• Benzenesulfonic acid, 2,5-dihydroxy-, calcium salt (2:1), dihydrate
• Calcium dobesilate dihydrate

Ethyl 3,6-dioxocyclohexa-1,4-diene-1-sulfonate

CAS: 117552-79-1

Ethyl 3,6-dioxocyclohexa-1,4-diene-1-sulfonate is an analog that has shown potential as an anticancer agent. It works by inhibiting kinases that are involved in cancer cell growth and proliferation. Studies have shown that this compound induces apoptosis in human tumor cells, making it a promising candidate for cancer treatment. Ethyl 3,6-dioxocyclohexa-1,4-diene-1-sulfonate has also been found to be a potent inhibitor of protein kinase D (PKD), which plays a key role in cancer cell survival and proliferation. This compound has been compared to the well-known kinase inhibitor saxagliptin and found to be more effective at inhibiting PKD activity. Additionally, Chinese hamster ovary cells treated with Ethyl 3,6-dioxocyclohexa-1,4-diene-1-sulfonate showed reduced levels of urinary ex

Formula: C₁₂H₁₂CaO₁₁S₂

Purity: Min. 95%

Molecular weight: 436.4 g/mol

Ref: 3D-SEA55279