CAS 1175536-50-1
:2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, (2R,3R)-, methanesulfonate (1:1)
Description:
2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, (2R,3R)-, methanesulfonate (1:1) is a complex organic compound characterized by its specific stereochemistry and functional groups. The presence of the butanediol moiety indicates that it has hydroxyl (-OH) groups, which contribute to its solubility in polar solvents and potential reactivity in various chemical reactions. The difluorophenyl group introduces significant electronegativity, which can influence the compound's electronic properties and interactions with biological targets. The triazole ring is known for its stability and ability to form hydrogen bonds, making it a common scaffold in pharmaceuticals. The methanesulfonate group serves as a counterion, enhancing the compound's solubility and stability in solution. Overall, this compound may exhibit interesting biological activities due to its diverse functional groups, making it a candidate for further research in medicinal chemistry and related fields. Its specific applications would depend on the interactions of its various components with biological systems.
Formula:C12H13F2N3O2·CH4O3S
InChI:InChI=1S/C12H13F2N3O2.CH4O3S/c1-8(18)12(19,5-17-7-15-6-16-17)10-3-2-9(13)4-11(10)14;1-5(2,3)4/h2-4,6-8,18-19H,5H2,1H3;1H3,(H,2,3,4)/t8-,12-;/m1./s1
InChI key:InChIKey=RWPFLARVZWFRBO-DAIXLEOSSA-N
SMILES:[C@](CN1C=NC=N1)([C@@H](C)O)(O)C2=C(F)C=C(F)C=C2.S(C)(=O)(=O)O
Synonyms:- (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol Mesylate
- 2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, (2R,3R)-, methanesulfonate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol Mesylate
CAS:Formula:C13H17F2N3O5SPurity:98%Color and Shape:SolidMolecular weight:365.3530Efinaconazole Impurity 35 Mesylate
CAS:Formula:C12H13F2N3O2·CH4O3SColor and Shape:White To Off-White SolidMolecular weight:269.25 96.10(2R,3R)-2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol methanesulfonate
CAS:(2R,3R)-2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol methanesulfonatePurity:98%Molecular weight:365.35g/mol(2R,3R)-2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol with methanesulfonate
CAS:Formula:C13H17F2N3O5SPurity:98%Molecular weight:365.35(2R,3R)- 2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-2,3-butanediol Methanesulfonate
CAS:Controlled Product<p>Applications (2R,3R)- 2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-2,3-butanediol Methanesulfonate is a useful synthetic intermediate in the synthesis of Efinaconazole (E435070); a topical antifungal for onychomycosis. (2R,3R)- 2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-2,3-butanediol Methanesulfonate is also used as a reagent in the synthesis of Ravuconazole (R128000); an ergosterol biosynthesis inhibitor and antifungal.<br>References Sugiura, K., et. al.: Antimicrob. Agents CH., 58, 3837 (2014); Pesti, J., et al.: Org. Process Res. Dev., 13, 716 (2009); Fung-Tomc., J.C., et al.: Antimicrob. Agents Chemother., 42, 313 (1988); Tsuruoka, A., et al.: Chem. Pharm. Bull., 46, 623 (1998); Gupta, A.K., et al.: J. Eur. Acad. Dermatol. Venereol., 19, 437 (2005)<br></p>Formula:C12H13F2N3O2·CH4O3SColor and Shape:NeatMolecular weight:365.35(2R,3R)-2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol methanesulfonate
CAS:(2R,3R)-2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol methanesulfonate is a useful organic compound for research related to life sciences. The catalog number is T67219 and the CAS number is 1175536-50-1.Formula:C13H17F2N3O5SColor and Shape:SolidMolecular weight:365.35






