CAS 1175560-94-7

B-[4-(Cyclopentylsulfonyl)phenyl]boronic acid

Description:

B-[4-(Cyclopentylsulfonyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a cyclopentylsulfonyl group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyclopentylsulfonyl moiety enhances its solubility and stability, potentially influencing its reactivity and interaction with biological targets. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's structure suggests it may have applications in drug development, particularly in the design of inhibitors for specific biological pathways. Overall, B-[4-(Cyclopentylsulfonyl)phenyl]boronic acid represents a versatile building block in synthetic chemistry, with potential implications in pharmaceuticals and materials science.

Formula: C₁₁H₁₅BO₄S

InChI: InChI=1S/C11H15BO4S/c13-12(14)9-5-7-11(8-6-9)17(15,16)10-3-1-2-4-10/h5-8,10,13-14H,1-4H2

InChI key: InChIKey=UXPQPYAEXRTCAM-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(B(O)O)C=C1)C2CCCC2

Synonyms:

• [4-(Cyclopentanesulfonyl)phenyl]boronic acid
• B-[4-(Cyclopentylsulfonyl)phenyl]boronic acid
• Boronic acid, B-[4-(cyclopentylsulfonyl)phenyl]-

[4-(Cyclopentanesulfonyl)phenyl]boronic acid

CAS: 1175560-94-7

Formula: C₁₁H₁₅BO₄S

Molecular weight: 254.1104

Ref: IN-DA00HE01