CymitQuimica logo

CAS 117559-37-2

:

diisopropyloctylchlorosilane

Description:
Diisopropyloctylchlorosilane, with the CAS number 117559-37-2, is an organosilicon compound characterized by its silane structure, which includes a silicon atom bonded to organic groups and a chlorine atom. This compound typically features two isopropyl groups and an octyl chain attached to the silicon, contributing to its hydrophobic properties. It is a colorless to pale yellow liquid at room temperature and is known for its reactivity, particularly due to the presence of the chlorosilane functional group, which can undergo hydrolysis to form silanol and subsequently condense to form siloxane networks. Diisopropyloctylchlorosilane is often utilized in surface modification applications, such as creating hydrophobic coatings on various substrates, and in the synthesis of silicone polymers. Its unique structure allows for enhanced compatibility with organic materials, making it valuable in various industrial applications, including adhesives, sealants, and as a coupling agent in composite materials. Proper handling and storage are essential due to its reactivity and potential health hazards associated with chlorosilanes.
Formula:C14H31ClSi
InChI:InChI=1/C14H31ClSi/c1-6-7-8-9-10-11-12-16(15,13(2)3)14(4)5/h13-14H,6-12H2,1-5H3
SMILES:CCCCCCCC[Si](C(C)C)(C(C)C)Cl
Synonyms:
  • Chloro(diisopropyl)octylsilane
  • Chloro[Bis(1-Methylethyl)]Octylsilane
  • n-Octyldiisopropylchlorosilane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.