CAS 117560-14-2
:benzyl 2-[[(1S)-2-tert-butoxy-1-methyl-2-oxo-ethyl]amino]-4-phenyl-butanoate
Description:
Benzyl 2-[[(1S)-2-tert-butoxy-1-methyl-2-oxo-ethyl]amino]-4-phenyl-butanoate, with CAS number 117560-14-2, is a synthetic organic compound characterized by its complex structure, which includes a benzyl group, a tert-butoxy moiety, and an amine functional group. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to its diverse functional groups, making it soluble in organic solvents while potentially having limited solubility in water. It may display biological activity, which could be of interest in pharmaceutical applications, particularly in drug design and development. The presence of the phenyl group suggests potential interactions with biological targets, while the tert-butoxy group may influence its stability and reactivity. Additionally, the compound's stereochemistry, indicated by the (1S) configuration, can significantly affect its biological activity and interaction with receptors. Overall, this compound represents a class of molecules that may have therapeutic potential, warranting further investigation into its pharmacological properties and mechanisms of action.
Formula:C24H31NO4
InChI:InChI=1/C24H31NO4/c1-18(22(26)29-24(2,3)4)25-21(16-15-19-11-7-5-8-12-19)23(27)28-17-20-13-9-6-10-14-20/h5-14,18,21,25H,15-17H2,1-4H3/t18-,21?/m0/s1
SMILES:C[C@@H](C(=O)OC(C)(C)C)NC(CCc1ccccc1)C(=O)OCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
