CAS 1175640-25-1
:2-(2-Fluorophenyl)-4-thiazolemethanol
Description:
2-(2-Fluorophenyl)-4-thiazolemethanol is a chemical compound characterized by its unique structural features, which include a thiazole ring and a fluorophenyl group. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the fluorine atom on the phenyl ring can enhance lipophilicity and influence the compound's interaction with biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological data would depend on empirical studies. Additionally, its solubility, stability, and reactivity can be influenced by the functional groups present in its structure. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can impart unique toxicological properties. Overall, 2-(2-Fluorophenyl)-4-thiazolemethanol represents a class of compounds that may have significant applications in medicinal chemistry and material science.
Formula:C10H8FNOS
InChI:InChI=1S/C10H8FNOS/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=CTRPELPWSRHYEL-UHFFFAOYSA-N
SMILES:FC1=C(C2=NC(CO)=CS2)C=CC=C1
Synonyms:- [2-(2-Fluorophenyl)-1,3-thiazol-4-yl]methanol
- (2-(2-Fluorophenyl)thiazol-4-yl)methanol
- 2-(2-Fluorophenyl)-4-thiazolemethanol
- 4-Thiazolemethanol, 2-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
