CymitQuimica logo

CAS 1175675-60-1

:

6-Bromo-4-chloro-9H-pyrido[2,3-b]indole

Description:
6-Bromo-4-chloro-9H-pyrido[2,3-b]indole is a heterocyclic organic compound characterized by its fused pyridine and indole structures, which contribute to its unique chemical properties. This compound features a bromine atom at the 6-position and a chlorine atom at the 4-position of the pyridine ring, influencing its reactivity and potential applications in medicinal chemistry. The presence of halogens often enhances the compound's biological activity and solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the compound may exhibit fluorescence properties, which can be useful in various analytical applications. As with many heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the reaction conditions. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks. Overall, 6-Bromo-4-chloro-9H-pyrido[2,3-b]indole represents a valuable compound for further research in organic and medicinal chemistry.
Formula:C11H6BrClN2
InChI:InChI=1S/C11H6BrClN2/c12-6-1-2-9-7(5-6)10-8(13)3-4-14-11(10)15-9/h1-5H,(H,14,15)
InChI key:InChIKey=FPIYJQSWTIINHV-UHFFFAOYSA-N
SMILES:ClC1=C2C=3C(NC2=NC=C1)=CC=C(Br)C3
Synonyms:
  • 6-Bromo-4-chloro-9H-pyrido[2,3-b]indole
  • 9H-Pyrido[2,3-b]indole, 6-bromo-4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.