CAS 1175689-25-4

(2R,3R)-2-(3-Chlorophenyl)-1-ethyl-6-oxo-3-piperidinecarboxylic acid

Description:

The chemical substance known as (2R,3R)-2-(3-Chlorophenyl)-1-ethyl-6-oxo-3-piperidinecarboxylic acid, with the CAS number 1175689-25-4, is characterized by its complex molecular structure, which includes a piperidine ring and a carboxylic acid functional group. This compound features a chiral center, indicating that it exists in two enantiomeric forms, which can exhibit different biological activities. The presence of the 3-chlorophenyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The oxo group contributes to its reactivity and may influence its pharmacokinetic properties. Additionally, the ethyl substituent enhances lipophilicity, potentially affecting the compound's solubility and permeability. Overall, this substance may have applications in pharmaceutical development, particularly in the design of drugs targeting specific receptors or enzymes, although its specific biological activity would require further investigation through experimental studies.

Formula: C₁₄H₁₆ClNO₃

InChI: InChI=1S/C14H16ClNO3/c1-2-16-12(17)7-6-11(14(18)19)13(16)9-4-3-5-10(15)8-9/h3-5,8,11,13H,2,6-7H2,1H3,(H,18,19)/t11-,13+/m1/s1

InChI key: InChIKey=FJUHZKMSZLYMCW-YPMHNXCESA-N

SMILES: C(C)N1[C@H]([C@H](C(O)=O)CCC1=O)C2=CC(Cl)=CC=C2

Synonyms:

• 3-Piperidinecarboxylic acid, 2-(3-chlorophenyl)-1-ethyl-6-oxo-, (2R,3R)-
• (2R,3R)-2-(3-Chlorophenyl)-1-ethyl-6-oxo-3-piperidinecarboxylic acid