CAS 117570-53-3: 5,6-Dimethylxanthenone-4-acetic acid
Description:5,6-Dimethylxanthenone-4-acetic acid, with the CAS number 117570-53-3, is a synthetic organic compound that belongs to the xanthenone family. This compound features a xanthenone core structure, which is characterized by a fused ring system containing both benzene and carbonyl functionalities. The presence of two methyl groups at the 5 and 6 positions contributes to its unique chemical properties, while the acetic acid moiety at the 4 position enhances its solubility in polar solvents. This compound is often studied for its potential applications in photochemistry and as a fluorescent probe due to its ability to absorb and emit light. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Its stability, reactivity, and solubility characteristics can vary based on environmental conditions, such as pH and temperature. Overall, 5,6-Dimethylxanthenone-4-acetic acid is a versatile compound with potential applications in various fields of research.
Formula:C17H14O4
InChI:InChI=1S/C17H14O4/c1-9-6-7-13-15(20)12-5-3-4-11(8-14(18)19)17(12)21-16(13)10(9)2/h3-7H,8H2,1-2H3,(H,18,19)
InChI key:InChIKey=XGOYIMQSIKSOBS-UHFFFAOYSA-N
SMILES:O=C(O)CC=1C=CC=C2C(=O)C3=CC=C(C(=C3OC21)C)C
- Synonyms:
- (5,6-Dimethyl-9-Oxo-Xanthen)-4-Acetic Acid
- (5,6-dimethyl-9-oxo-9H-xanthen-4-yl)acetic acid
- 2-(5,6-Dimethyl-9-oxo-9H-xanthen-4-yl)acetic acid
- 2-(5,6-Dimethyl-9-oxoxanthen-4-yl)acetic acid
- 5,6-Dimethyl-9-oxo-9H-xanthen-4-ylacetic acid
- 5,6-Dimethyl-9-oxo-9H-xanthene-4-acetic acid
- 5,6-Dimethylxanthenone-4-acetic acid
- 5,6-Dimethylxanthenoneacetic Acid
- 9H-Xanthene-4-acetic acid, 5,6-dimethyl-9-oxo-
- As 1404
- See more synonyms
- Asa 404
- D5817
- Dmxaa
- NSC 640488
- Vadimezan
