CymitQuimica logo

CAS 117572-80-2

:

1,3,4-Tribromo-2,5-dimethylbenzene

Description:
1,3,4-Tribromo-2,5-dimethylbenzene, with the CAS number 117572-80-2, is an aromatic compound characterized by the presence of three bromine atoms and two methyl groups attached to a benzene ring. The bromine substituents are located at the 1, 3, and 4 positions, while the methyl groups are at the 2 and 5 positions, contributing to its unique structural and chemical properties. This compound is typically a solid at room temperature and may exhibit a crystalline form. Its brominated nature suggests it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The presence of bromine atoms can enhance the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitution. Additionally, the methyl groups can influence the compound's solubility and stability. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with brominated organic compounds.
Formula:C8H7Br3
InChI:InChI=1S/C8H7Br3/c1-4-3-6(9)5(2)8(11)7(4)10/h3H,1-2H3
InChI key:InChIKey=RHEOGFMVFVUFRG-UHFFFAOYSA-N
SMILES:BrC1=C(Br)C(C)=C(Br)C=C1C
Synonyms:
  • 1,3,4-Tribromo-2,5-dimethylbenzene
  • Benzene, 1,3,4-tribromo-2,5-dimethyl-
  • 2,3,5-Tribromo-1,4-dimethylbenzene
  • 2,3,6-Tribromo-p-xylene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.