CAS 1176-52-9: Gramisterol

Description:Gramisterol, with the CAS number 1176-52-9, is a naturally occurring sterol primarily derived from various plant sources. It is characterized by its structural similarity to cholesterol, featuring a steroid backbone with specific functional groups that contribute to its biological activity. Gramisterol is known for its potential health benefits, including cholesterol-lowering properties and its role in cellular membrane fluidity. It exhibits hydrophobic characteristics due to its steroid structure, which influences its solubility in organic solvents rather than in water. Additionally, gramisterol may possess antioxidant properties, contributing to its significance in nutritional and pharmaceutical applications. Its presence in certain foods and supplements highlights its relevance in promoting cardiovascular health and overall well-being. As with many sterols, the bioavailability and efficacy of gramisterol can be influenced by its formulation and the presence of other compounds in dietary sources. Further research continues to explore its mechanisms of action and potential therapeutic uses.

Formula:C₂₉H₄₈O

InChI:InChI=1S/C29H48O/c1-18(2)19(3)8-9-20(4)23-12-13-25-22-10-11-24-21(5)27(30)15-17-29(24,7)26(22)14-16-28(23,25)6/h10,18,20-21,23-27,30H,3,8-9,11-17H2,1-2,4-7H3/t20-,21+,23-,24+,25+,26+,27+,28-,29+/m1/s1

InChI key:InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N

SMILES:OC1CCC2(C)C3C(=CCC2C1C)C4CCC(C(C)CCC(=C)C(C)C)C4(C)CC3

Synonyms:
(3β,4α,5α)-4-Methylergosta-7,24(28)-dien-3-ol
24-Methylenelophenol
Lophenol, 24-methylene-
Ergosta-7,24(28)-dien-3-ol, 4-methyl-, (3β,4α,5α)-
5α-Ergosta-7,24(28)-dien-3β-ol, 4α-methyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Gramisterol REF: 4Z-G-213001CAS: 1176-52-9	- - -	To inquire	Thu 03 Apr 25
Gramisterol REF: TR-E599215CAS: 1176-52-9	- - -	317.00 €~2,144.00 €	Tue 08 Apr 25
Gramisterol REF: 3D-BAA17652CAS: 1176-52-9	Min. 95%	To inquire	Thu 08 May 25