CAS 1176-52-9
:Gramisterol
Description:
Gramisterol, with the CAS number 1176-52-9, is a naturally occurring sterol primarily derived from various plant sources. It is characterized by its structural similarity to cholesterol, featuring a steroid backbone with specific functional groups that contribute to its biological activity. Gramisterol is known for its potential health benefits, including cholesterol-lowering properties and its role in cellular membrane fluidity. It exhibits hydrophobic characteristics due to its steroid structure, which influences its solubility in organic solvents rather than in water. Additionally, gramisterol may possess antioxidant properties, contributing to its significance in nutritional and pharmaceutical applications. Its presence in certain foods and supplements highlights its relevance in promoting cardiovascular health and overall well-being. As with many sterols, the bioavailability and efficacy of gramisterol can be influenced by its formulation and the presence of other compounds in dietary sources. Further research continues to explore its mechanisms of action and potential therapeutic uses.
Formula:C29H48O
InChI:InChI=1S/C29H48O/c1-18(2)19(3)8-9-20(4)23-12-13-25-22-10-11-24-21(5)27(30)15-17-29(24,7)26(22)14-16-28(23,25)6/h10,18,20-21,23-27,30H,3,8-9,11-17H2,1-2,4-7H3/t20-,21+,23-,24+,25+,26+,27+,28-,29+/m1/s1
InChI key:InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
SMILES:C[C@@]12[C@@]3(C([C@]4([C@](C)(CC3)[C@@]([C@@H](CCC(C(C)C)=C)C)(CC4)[H])[H])=CC[C@]1([C@H](C)[C@@H](O)CC2)[H])[H]
Synonyms:- (3β,4α,5α)-4-Methylergosta-7,24(28)-dien-3-ol
- 24-Methylenelophenol
- Lophenol, 24-methylene-
- Ergosta-7,24(28)-dien-3-ol, 4-methyl-, (3β,4α,5α)-
- 5α-Ergosta-7,24(28)-dien-3β-ol, 4α-methyl-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Gramisterol
CAS:Controlled ProductGramisterol is a medicinal compound that has shown potent anticancer properties. It is derived from urine and has been found to inhibit protein kinase activity in human cancer cells, leading to apoptosis or programmed cell death. Gramisterol has been studied extensively in Chinese medicine for its ability to inhibit tumor growth and promote cell cycle arrest in leukemia cells. Additionally, it acts as an inhibitor of other cancer-related proteins and enzymes, making it a promising candidate for future cancer therapies. Its natural origin and potent anticancer effects make it a valuable addition to any cancer treatment regimen.Formula:C29H48OPurity:Min. 95%Molecular weight:412.7 g/mol


