
CAS 1176-88-1
:5-Hydroxy-3,6,7,8,3′,4′-hexamethoxyflavone
Description:
5-Hydroxy-3,6,7,8,3′,4′-hexamethoxyflavone, with the CAS number 1176-88-1, is a flavonoid compound characterized by its complex methoxy-substituted structure. This substance features multiple methoxy groups, which contribute to its solubility and potential biological activity. The presence of a hydroxyl group enhances its reactivity and may influence its antioxidant properties. Flavonoids, in general, are known for their diverse pharmacological effects, including anti-inflammatory, antioxidant, and anticancer activities. The specific arrangement of methoxy groups in this compound can affect its interaction with biological targets, potentially leading to various health benefits. Additionally, its structural characteristics may influence its stability, bioavailability, and metabolic pathways. Research into this compound may reveal insights into its potential applications in nutraceuticals or pharmaceuticals, particularly in the context of health-promoting properties associated with flavonoids. However, further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C21H22O9
InChI:InChI=1S/C21H22O9/c1-24-11-8-7-10(9-12(11)25-2)16-18(26-3)14(22)13-15(23)19(27-4)21(29-6)20(28-5)17(13)30-16/h7-9,23H,1-6H3
InChI key:InChIKey=JDVPHCLYMGBZLE-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C(=O)C(OC)=C(O2)C3=CC(OC)=C(OC)C=C3)=C(O)C(OC)=C1OC
Synonyms:- 5-Hydroxy-3,6,7,8,3′,4′-hexamethoxyflavone
- Flavone, 5-hydroxy-3,3′,4′,6,7,8-hexamethoxy-
- 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one
- NSC 618935
- 4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-5-hydroxy-3,6,7,8-tetramethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
