CAS 1176103-92-6
:1-[2-(Trifluoromethyl)phenyl]cyclopentanamine
Description:
1-[2-(Trifluoromethyl)phenyl]cyclopentanamine, identified by its CAS number 1176103-92-6, is an organic compound characterized by its unique molecular structure, which includes a cyclopentanamine core substituted with a trifluoromethyl group on a phenyl ring. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the presence of fluorine atoms often imparts unique characteristics, such as increased metabolic stability and altered pharmacokinetics in biological systems. Overall, this compound may be explored for applications in drug development or as a building block in synthetic organic chemistry, owing to its distinctive structural features and potential biological activity.
Formula:C12H14F3N
InChI:InChI=1S/C12H14F3N/c13-12(14,15)10-6-2-1-5-9(10)11(16)7-3-4-8-11/h1-2,5-6H,3-4,7-8,16H2
InChI key:InChIKey=DOYGNAKYWAMZJX-UHFFFAOYSA-N
SMILES:NC1(C2=C(C(F)(F)F)C=CC=C2)CCCC1
Synonyms:- 1-[2-(Trifluoromethyl)phenyl]cyclopentanamine
- Cyclopentanamine, 1-[2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.