CAS 117620-77-6
:3-CYANO-7-ETHOXYCOUMARIN
Description:
3-Cyano-7-ethoxycoumarin is a synthetic organic compound belonging to the coumarin family, characterized by its unique structure that includes a cyano group and an ethoxy substituent. This compound typically exhibits a yellow to greenish-yellow color and is known for its fluorescence properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. The presence of the cyano group enhances its reactivity and solubility in organic solvents, while the ethoxy group contributes to its stability and solubility in polar environments. 3-Cyano-7-ethoxycoumarin is often utilized in research for studying cellular processes, as well as in the development of dyes and sensors. Its photophysical properties, such as absorption and emission spectra, can be influenced by environmental factors, including pH and polarity of the solvent. Overall, this compound is valued for its versatility in scientific research and potential applications in materials science and biochemistry.
Formula:C12H9NO3
InChI:InChI=1/C12H9NO3/c14-11(8-4-2-1-3-5-8)9-6-10(12(15)16)13-7-9/h1-7,13H,(H,15,16)
SMILES:c1ccc(cc1)C(=O)c1cc(C(=O)O)[nH]c1
Synonyms:- 7-Ethoxycoumarin-3-Carbonitrile
- 2H-1-Benzopyran-3-carbonitrile,7-ethoxy-2-oxo-(9CI)
- 7-ethoxy-2-oxo-2H-chromene-3-carbonitrile
- 4-(phenylcarbonyl)-1H-pyrrole-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Cyano-7-ethoxycoumarin
CAS:Formula:C12H9NO3Purity:97%Color and Shape:SolidMolecular weight:215.20483-Cyano-7-ethoxycoumarin
CAS:3-Cyano-7-ethoxycoumarin is cytochrome P450 (CYP) isoforms CYP1A1 and CYP1A2 .Formula:C12H9NO3Purity:>99.99%Color and Shape:Yellow To OrangeMolecular weight:215.23-Cyano-7-ethoxycoumarin
CAS:Controlled ProductApplications 3-Cyano-7-ethoxycoumarin is a fluorescent p450 substrate metabolized to cyanohydroxycoumarin. Used as a diagnostic to measure the efficacy of various CYP450 enzymes.
References Wang, H. et al.: Xenobiotica, 41, 826(1996);Formula:C12H9NO3Color and Shape:NeatMolecular weight:215.23-Cyano-7-ethoxycoumarin
CAS:3-Cyano-7-ethoxycoumarin is a specialized fluorescent probe, which is a synthetic organic compound designed for use in biochemical assays. This compound is sourced from the broader family of coumarins, which are known for their versatile fluorescence properties. The mode of action of 3-Cyano-7-ethoxycoumarin involves its ability to exhibit strong fluorescent emission when excited by specific wavelengths of light, making it a valuable tool for monitoring biochemical reactions and interactions.
Formula:C12H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:215.2 g/mol






