CAS 117620-87-8
:8-O-Methyltetrangomycin
Description:
8-O-Methyltetrangomycin is a chemical compound that belongs to the class of tetracycline antibiotics, which are known for their broad-spectrum antibacterial activity. This substance is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. It exhibits properties such as antimicrobial efficacy against various Gram-positive and Gram-negative bacteria, making it a subject of interest in medicinal chemistry. The compound's mechanism of action typically involves inhibition of protein synthesis by binding to the bacterial ribosome. Additionally, 8-O-Methyltetrangomycin may possess unique pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion in biological systems. Research into this compound may also explore its potential therapeutic applications, side effects, and resistance mechanisms. As with many antibiotics, the development of resistance is a significant concern, prompting ongoing studies to optimize its use and effectiveness in clinical settings.
Formula:C20H16O5
InChI:InChI=1/C20H16O5/c1-20(24)8-10-6-7-12-17(15(10)13(21)9-20)19(23)11-4-3-5-14(25-2)16(11)18(12)22/h3-7,24H,8-9H2,1-2H3
InChI key:InChIKey=XZLGWJORNHETKI-HXUWFJFHSA-N
SMILES:O=C1C=2C3=C(C=CC2C(=O)C=4C1=CC=CC4OC)C[C@@](C)(O)CC3=O
Synonyms:- (3R)-3,4-Dihydro-3-hydroxy-8-methoxy-3-methylbenz[a]anthracene-1,7,12(2H)-trione
- MM 47755
- 6-Deoxy-8-O-methylrabelomycin
- 8-O-Methyltetrangomycin
- Benz[a]anthracene-1,7,12(2H)-trione, 3,4-dihydro-3-hydroxy-8-methoxy-3-methyl-, (3R)-
- 6-Deoxy-8-O-methylrabelomycin (MM 47755)
- (-)-3,4-Dihydro-3-hydroxy-8-methoxy-3-methylbenz[a]anthracene-1,7,12(2H)-trione
- MM 47755 (6-Deoxy-8-O-methylrabelomycin)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Deoxy-8-O-methylrabelomycin
CAS:Formula:C20H16O5Purity:81.36%Color and Shape:Brownish. SolidMolecular weight:336.06-Deoxy-8-O-methylrabelomycin
CAS:6-Deoxy-8-O-methylrabelomycin is a useful organic compound for research related to life sciences.Formula:C20H16O5Color and Shape:SolidMolecular weight:336.3436-Deoxy-8-O-methylrabelomycin
CAS:Formula:C20H16O5Purity:≥ 97.0%Color and Shape:Off-white to yellow solidMolecular weight:336.3MM 47755
CAS:MM 47755 is a natural compound that has demonstrated inhibitory activity against the enolate of glycopeptide antibiotics. It is an enantiopure molecule, which means it is composed of a single type of chiral center. MM 47755 is an inhibitor of bacterial enzymes that are involved in the synthesis and degradation of glycopeptide antibiotics. MM 47755 binds to these enzymes (enolases) in a manner similar to those of the natural substrate, slowing down their metabolic activity and leading to inhibition.Formula:C20H16O5Purity:Min. 95%Molecular weight:336.34 g/mol




