
CAS 117623-47-9
:1-Benzyl-2,2-dimethylpiperidin-4-ol
Description:
1-Benzyl-2,2-dimethylpiperidin-4-ol is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a benzyl group at the first position and two methyl groups at the second position contributes to its unique properties. This compound features a hydroxyl (-OH) group at the fourth position, which enhances its solubility in polar solvents and may influence its reactivity and biological activity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions. The compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of the piperidine moiety suggests that it may have properties similar to other piperidine derivatives, which are often used in the synthesis of pharmaceuticals and agrochemicals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C14H21NO
InChI:InChI=1S/C14H21NO/c1-14(2)10-13(16)8-9-15(14)11-12-6-4-3-5-7-12/h3-7,13,16H,8-11H2,1-2H3
InChI key:InChIKey=PQOBJUIKMNOJMP-UHFFFAOYSA-N
SMILES:C(N1C(C)(C)CC(O)CC1)C2=CC=CC=C2
Synonyms:- 4-Piperidinol, 2,2-dimethyl-1-(phenylmethyl)-
- 1-Benzyl-2,2-dimethylpiperidin-4-ol
- 2,2-Dimethyl-1-(phenylmethyl)-4-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.