CAS 1176335-27-5

4-Amino-3-fluoro-2-methylbenzeneacetonitrile

Description:

4-Amino-3-fluoro-2-methylbenzeneacetonitrile, with the CAS number 1176335-27-5, is an organic compound characterized by the presence of an amino group, a fluorine atom, and a nitrile functional group attached to a benzene ring. This compound features a methyl group that contributes to its overall hydrophobic character. The amino group (-NH2) typically imparts basic properties, while the nitrile group (-C≡N) is known for its polar characteristics, which can enhance solubility in polar solvents. The fluorine atom introduces electronegativity, influencing the compound's reactivity and interaction with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in the synthesis of more complex organic molecules or as intermediates in various chemical reactions. Overall, the unique combination of functional groups in 4-Amino-3-fluoro-2-methylbenzeneacetonitrile contributes to its distinct chemical behavior and potential utility in various fields, including medicinal chemistry and materials science.

Formula: C₉H₉FN₂

InChI: InChI=1S/C9H9FN2/c1-6-7(4-5-11)2-3-8(12)9(6)10/h2-3H,4,12H2,1H3

InChI key: InChIKey=WUDMNZJUXLCWKX-UHFFFAOYSA-N

SMILES: C(C#N)C1=C(C)C(F)=C(N)C=C1

Synonyms:

• (4-Amino-3-fluoro-2-methylphenyl)acetonitrile
• 4-Amino-3-fluoro-2-methylbenzeneacetonitrile
• Benzeneacetonitrile, 4-amino-3-fluoro-2-methyl-
• 2-(4-Amino-3-fluoro-2-methylphenyl)acetonitrile