CAS 117641-39-1
:(1S,2R,3S,5R)-2-(Benzyloxymethyl)-6-oxabicyclo[3.1.0]hexan-3-ol
Description:
The chemical substance known as "(1S,2R,3S,5R)-2-(Benzyloxymethyl)-6-oxabicyclo[3.1.0]hexan-3-ol," with the CAS number 117641-39-1, is a bicyclic compound characterized by its unique structural features, including a bicyclo[3.1.0]hexane framework and a benzyloxymethyl substituent. This compound contains multiple stereocenters, which contribute to its specific stereochemistry, influencing its reactivity and interactions with biological systems. The presence of the oxabicyclic structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The hydroxyl group (alcohol functional group) enhances its polarity, potentially affecting solubility and reactivity. Additionally, the benzyloxymethyl group may provide opportunities for further functionalization or serve as a protective group in synthetic pathways. Overall, this compound's structural complexity and functional groups make it a subject of interest in various chemical research fields, including synthetic organic chemistry and drug design.
Formula:C13H16O3
InChI:InChI=1/C13H16O3/c14-11-6-12-13(16-12)10(11)8-15-7-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2/t10-,11+,12-,13+/m1/s1
Synonyms:- [1S-(1Α,2Α, 3Β,5Α)]-2-[(Phenmethoxy)-Methyl]-6-Oxabicyclo[3,1,0]Hexan-3-Ol
- (1S,2R,3S,5R)-2-((4-methylbenzyloxy)methyl)-6-oxabicyclo[3.1.0]hexan-3-ol
- Entecavir intermediate 2
- Ent-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(1S,2R,3S,5R)-2-((Benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexan-3-ol
CAS:Formula:C13H16O3Purity:%Color and Shape:LiquidMolecular weight:220.2643(1S,2R,3S,5R)-2-((Benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexan-3-ol
CAS:(1S,2R,3S,5R)-2-((Benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexan-3-olPurity:95%Molecular weight:220.27g/mol(1S,2R,3S,5R)-2-((Benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexan-3-ol
CAS:(1S,2R,3S,5R)-2-((Benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexan-3-ol is a fine chemical with a CAS No. of 117641-39-1. It has been used as a versatile building block in the synthesis of complex compounds, and has also been used as a useful intermediate in the production of specialty chemicals. This compound is useful for research purposes and can be used as a reaction component in the synthesis of new compounds.Formula:C13H16O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:220.26 g/mol(1S,2R,3S,5R)-2-[(Phenylmethoxy)methyl]-6-oxabicyclo[3.1.0]hexan-3-ol
CAS:Controlled ProductFormula:C13H16O3Color and Shape:ColourlessMolecular weight:220.26






