CAS 1176419-59-2

1-Piperazineethanol, 4-(1-methylpropyl)-, hydrochloride (1:2)

Description:

1-Piperazineethanol, 4-(1-methylpropyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and ethanol functional groups, which contribute to its potential applications in medicinal chemistry. The presence of the hydrochloride salt form enhances its solubility in water, making it more bioavailable for pharmaceutical formulations. This compound typically exhibits properties such as being a white crystalline solid, with a moderate melting point and stability under standard laboratory conditions. Its structure suggests potential interactions with biological systems, particularly in the central nervous system, due to the piperazine moiety, which is known for its activity in various therapeutic areas. Additionally, the presence of the 1-methylpropyl group may influence its lipophilicity and pharmacokinetic properties. As with many piperazine derivatives, it may exhibit a range of biological activities, including anxiolytic or antidepressant effects, although specific biological data would be necessary to confirm these activities. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₂₂N₂O·2ClH

InChI: InChI=1S/C10H22N2O.2ClH/c1-3-10(2)12-6-4-11(5-7-12)8-9-13;;/h10,13H,3-9H2,1-2H3;2*1H

InChI key: InChIKey=SWXKEMKGPPMGKG-UHFFFAOYSA-N

SMILES: C(CC)(C)N1CCN(CCO)CC1.Cl

Synonyms:

• 1-Piperazineethanol, 4-(1-methylpropyl)-, hydrochloride (1:2)

2-[4-(Butan-2-yl)piperazin-1-yl]ethan-1-ol dihydrochloride

CAS: 1176419-59-2

2-[4-(Butan-2-yl)piperazin-1-yl]ethan-1-ol dihydrochloride

Molecular weight: 259.21636g/mol

Ref: 54-OR1021189

2-[4-(2-Butyl)-piperazin-1-yl]-ethanoldihydrochloride

CAS: 1176419-59-2

Formula: C₁₀H₂₄Cl₂N₂O

Purity: 99.0%

Molecular weight: 259.22

Ref: 10-F033875