CAS 117652-28-5

2-Methoxy-4-[2-(methylamino)propyl]phenol

Description:

2-Methoxy-4-[2-(methylamino)propyl]phenol, with the CAS number 117652-28-5, is an organic compound characterized by its phenolic structure, which includes a methoxy group and a side chain containing a methylamino group. This compound typically exhibits properties associated with both phenols and amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the hydroxyl (-OH) group. The presence of the methoxy group can influence its reactivity and stability, while the methylamino group may impart basicity and affect its interaction with biological systems. This compound may be of interest in pharmaceutical research and development due to its structural features, which could contribute to various biological activities. Additionally, its molecular structure suggests potential applications in the synthesis of other chemical entities or as a precursor in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1S/C11H17NO2/c1-8(12-2)6-9-4-5-10(13)11(7-9)14-3/h4-5,7-8,12-13H,6H2,1-3H3

InChI key: InChIKey=UVDWYWYWOMOEFX-UHFFFAOYSA-N

SMILES: C(C(NC)C)C1=CC(OC)=C(O)C=C1

Synonyms:

• 2-Methoxy-4-(2-(methylamino)propyl)phenol
• 4,3-Hmm
• Phenol, 2-methoxy-4-(2-(methylamino)propyl)-