CymitQuimica logo

CAS 1176535-07-1

:

3-(pyridin-3-yl)-1H-indazol-5-amine

Description:
3-(Pyridin-3-yl)-1H-indazol-5-amine is a chemical compound characterized by its unique structure, which includes an indazole core substituted with a pyridine ring and an amine group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen atoms in its structure. The indazole moiety is known for its role in various pharmacological applications, while the pyridine ring can contribute to the compound's ability to interact with biological targets. The amine group may enhance solubility and reactivity, making it a candidate for further chemical modifications or as a lead compound in drug discovery. Additionally, the compound's molecular interactions can be influenced by factors such as hydrogen bonding and π-π stacking, which are common in aromatic systems. Overall, 3-(pyridin-3-yl)-1H-indazol-5-amine represents a class of compounds that may have significant implications in medicinal chemistry and material science.
Formula:C12H10N4
InChI:InChI=1S/C12H10N4/c13-9-3-4-11-10(6-9)12(16-15-11)8-2-1-5-14-7-8/h1-7H,13H2,(H,15,16)
SMILES:c1cc(cnc1)c1c2cc(ccc2[nH]n1)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.