CymitQuimica logo

CAS 117666-86-1

:

O-ethyl (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enethioate

Description:
O-ethyl (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enethioate is an organic compound characterized by its unique structure, which includes an ethyl group, a prop-2-enethioate moiety, and a phenyl ring substituted with three methoxy groups. This compound features a conjugated system due to the presence of the double bond in the prop-2-enethioate part, which can contribute to its reactivity and potential applications in organic synthesis or as a bioactive molecule. The methoxy groups on the phenyl ring enhance its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the thioate functional group can participate in various chemical reactions, such as nucleophilic substitutions or additions. Overall, the compound's structural characteristics suggest potential utility in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C14H18O4S
InChI:InChI=1/C14H18O4S/c1-5-18-13(19)7-6-10-8-11(15-2)14(17-4)12(9-10)16-3/h6-9H,5H2,1-4H3/b7-6+
Synonyms:
  • 2-Propenethioic acid, 3-(3,4,5-trimethoxyphenyl)-, O-ethyl ester
  • See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.