CAS 117671-01-9: 3-(Ethylsulfonyl)-2-pyridinesulfonamide
Description:3-(Ethylsulfonyl)-2-pyridinesulfonamide, with the CAS number 117671-01-9, is a chemical compound characterized by its sulfonamide functional groups and a pyridine ring. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, due to the presence of the sulfonamide moiety. The ethylsulfonyl group enhances its solubility and may influence its biological activity. The pyridine ring contributes to the compound's aromaticity and can participate in various chemical interactions, making it a versatile building block in medicinal chemistry. Additionally, the presence of both sulfonyl and sulfonamide groups suggests that it may engage in hydrogen bonding, which can affect its reactivity and interactions with biological targets. Overall, this compound's unique structure may lead to interesting pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C7H10N2O4S2
InChI:InChI=1S/C7H10N2O4S2/c1-2-14(10,11)6-4-3-5-9-7(6)15(8,12)13/h3-5H,2H2,1H3,(H2,8,12,13)
InChI key:InChIKey=ZVAJJLYQUHJURI-UHFFFAOYSA-N
SMILES:O=S(=O)(N)C1=NC=CC=C1S(=O)(=O)CC
- Synonyms:
- 2-(Aminosulfonyl)-3-(ethylsulfonyl)pyridine
- 2-Pyridinesulfonamide, 3-(ethylsulfonyl)-
- 3-(Ethylsulfonyl)Pyridine-2-Sulfonamide
- 3-Ethanesulfonyl-Pyridine-2-Sulfonic Acid Amide
- 3-Ethanesulfonylpyridine-2-Sulfonamide
- 3-Ethylsulfo-2-Aminosulfo-Pyridine
- Chempacific 41225
- 3-(Ethylsulfonyl)-2-pyridinesulfonamide
