CAS 117690-79-6

1-[5-ETHYL-2-HYDROXY-4-[[6-METHYL-6-(1H-TETRAZOL-5-YL)HEPTYL]OXY]PHENYL]ETHANONE

Description:

1-[5-Ethyl-2-hydroxy-4-[[6-methyl-6-(1H-tetrazol-5-yl)heptyl]oxy]phenyl]ethanone, with the CAS number 117690-79-6, is a synthetic organic compound characterized by its complex structure, which includes a phenolic moiety, a ketone functional group, and a tetrazole ring. This compound features a hydroxyl group that contributes to its potential solubility in polar solvents, while the ethyl and heptyl substituents enhance its hydrophobic characteristics. The presence of the tetrazole ring may impart unique biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, which may affect its interactions in various chemical environments. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in advanced chemical and pharmaceutical applications.

Formula: C₁₉H₂₈N₄O₃

InChI: InChI=1/C19H28N4O3/c1-5-14-11-15(13(2)24)16(25)12-17(14)26-10-8-6-7-9-19(3,4)18-20-22-23-21-18/h11-12,25H,5-10H2,1-4H3,(H,20,21,22,23)

SMILES: CCc1cc(C(=O)C)c(cc1OCCCCCC(C)(C)c1n[nH]nn1)O

Synonyms:

• Ly 255283
• 1-[5-Ethyl-2-Hydroxy-4-[[6-Methyl-6-(1H-Tetrazole-5-Yl)Heptyl]Oxy]Phenyl]-Ethanone
• 1-(5-ethyl-2-hydroxy-4-{[6-methyl-6-(2H-tetrazol-5-yl)heptyl]oxy}phenyl)ethanone

LY-255283

CAS: 117690-79-6

Formula: C₁₉H₂₈N₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 360.4506

Ref: IN-DA007QTW

LY255283

CAS: 117690-79-6

LY255283

Purity: ≥98%

Molecular weight: 360.45g/mol

Ref: 54-BUP13032

LY255283

CAS: 117690-79-6

Formula: C₁₉H₂₈N₄O₃

Molecular weight: 360.45

Ref: 7W-GK2792

LY255283

CAS: 117690-79-6

LY255283 is a specific antagonit of leukotriene B4 (LTB4) receptor. It inhibits the production of LTB(4) in human PMNL and in monocytes.

Formula: C₁₉H₂₈N₄O₃

Purity: 99.18%

Color and Shape: Solid

Molecular weight: 360.45

Ref: TM-T22946

1-(5-ethyl-2-hydroxy-4-{[6-methyl-6-(1H-1,2,3,4-tetrazol-5-yl)heptyl]oxy}phenyl)ethan-1-one

CAS: 117690-79-6

Purity: 98%

Molecular weight: 360.4580078

Ref: 10-F869948

LY-255283

CAS: 117690-79-6

LY-255283 is a potent leukotriene B4 (LTB4) receptor antagonist, which is a synthetic compound developed for research purposes. The source of LY-255283 is a chemically synthesized molecule designed to interfere with the biological pathways mediated by leukotriene B4, a pro-inflammatory lipid mediator involved in various inflammatory responses.

Formula: C₁₉H₂₈N₄O₃

Purity: Min. 95%

Molecular weight: 360.45 g/mol

Ref: 3D-SEA69079