CAS 117693-18-2

Furan, 2-methyl-3-(2-nitroethenyl)-, (E)-

Description:

Furan, 2-methyl-3-(2-nitroethenyl)-, (E)-, with the CAS number 117693-18-2, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing four carbon atoms and one oxygen atom. The compound features a methyl group and a nitroethenyl substituent, contributing to its unique reactivity and properties. As an unsaturated compound, it may exhibit electrophilic and nucleophilic behavior, making it of interest in various chemical reactions, including those in organic synthesis. The (E)- configuration indicates the specific geometric arrangement of the substituents around the double bond, which can influence its chemical behavior and interactions. Furan derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their ability to participate in diverse chemical transformations. Additionally, the presence of the nitro group may impart specific electronic properties, affecting the compound's reactivity and stability. Overall, this compound exemplifies the complexity and versatility of furan derivatives in organic chemistry.

Formula: C₇H₇NO₃

InChI: InChI=1S/C7H7NO3/c1-6-7(3-5-11-6)2-4-8(9)10/h2-5H,1H3/b4-2+

InChI key: InChIKey=ZBBLKDSSWQDZTP-DUXPYHPUSA-N

SMILES: C(=C/N(=O)=O)\C1=C(C)OC=C1

Synonyms:

• Furan, 2-methyl-3-(2-nitroethenyl)-, (E)-