CAS 117695-55-3

3,5-Dibromobenzeneboronic acid

Description:

3,5-Dibromobenzeneboronic acid is an organoboron compound characterized by the presence of both bromine and boronic acid functional groups attached to a benzene ring. It features two bromine atoms located at the 3 and 5 positions of the aromatic ring, which significantly influences its reactivity and solubility. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. The presence of the boron atom allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and materials science. Additionally, the bromine substituents can serve as leaving groups, enhancing its utility in further functionalization. 3,5-Dibromobenzeneboronic acid is also of interest in medicinal chemistry and the development of pharmaceuticals due to its potential biological activity. Proper handling and storage are essential, as with many organoboron compounds, to ensure safety and stability.

Formula: C₆H₅BBr₂O₂

InChI: InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H

SMILES: c1c(cc(cc1Br)Br)B(O)O

Synonyms:

• 3,5-Dibromophenylboronic acid
• 3,5-Dibrombenzolboronsaeure
• 3,5-Dibromophenyl boronic acid

3,5-Dibromophenylboronic Acid (contains varying amounts of Anhydride)

CAS: 117695-55-3

Formula: C₆H₅BBr₂O₂

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 279.72

Ref: 3B-D4670

3,5-Dibromobenzeneboronic acid, 97%

CAS: 117695-55-3

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₆H₅BBr₂O₂

Purity: 97%

Color and Shape: Powder, Pale cream to cream to yellow

Molecular weight: 279.72

Ref: 02-B23863

3,5-Dibromophenylboronic acid

CAS: 117695-55-3

Formula: C₆H₅BBr₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.7217

Ref: IN-DA0077KM

3,5-Dibromophenylboronic acid

CAS: 117695-55-3

3,5-Dibromophenylboronic acid

Purity: 98%

Molecular weight: 279.72g/mol

Ref: 54-OR74758

3,5-Dibromobenzeneboronic acid 98%

CAS: 117695-55-3

3,5-Dibromobenzeneboronic acid 98%

Purity: 98%

Ref: 54-OR10439

3,5-Dibromophenylboronic acid

CAS: 117695-55-3

3,5-Dibromophenylboronic acid is a boronic acid with the chemical formula B(OH)Br. The boron atom in this molecule has a unique electron configuration that allows it to form strong bonds with other atoms and molecules. This reactive compound can be used as a ligand in cross-coupling reactions or to modify an organic molecule by coupling it to another molecule. 3,5-Dibromophenylboronic acid is typically used as a precursor for the synthesis of nanomaterials and can be synthesized from monomers at temperatures ranging from -78°C to 80°C.

Formula: C₆H₅BBr₂O₂

Purity: Min. 95%

Molecular weight: 279.72 g/mol

Ref: 3D-FD33437

3,5-Dibromophenylboronic acid

CAS: 117695-55-3

Formula: C₆H₅BBr₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.72

Ref: 10-F045273