CymitQuimica logo

CAS 117701-62-9

:

2-Pyridinecarboximidoyl chloride

Description:
2-Pyridinecarboximidoyl chloride, with the CAS number 117701-62-9, is a chemical compound characterized by its functional groups and structural features. It is derived from pyridine, a six-membered aromatic ring containing nitrogen, and features a carboximidoyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the presence of the imidoyl chloride group, which can participate in various chemical reactions, including nucleophilic substitutions and acylation processes. The compound is often used in organic synthesis, particularly in the preparation of more complex molecules, and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety precautions are essential when handling this compound, as it may be corrosive and can release harmful gases upon reaction with water or moisture. Proper storage and handling in a controlled environment are recommended to mitigate any risks associated with its reactivity.
Formula:C6H5ClN2
InChI:InChI=1S/C6H5ClN2/c7-6(8)5-3-1-2-4-9-5/h1-4,8H
InChI key:InChIKey=QPHNCXIHRZHLNZ-UHFFFAOYSA-N
SMILES:C(Cl)(=N)C1=CC=CC=N1
Synonyms:
  • 2-Pyridinecarboximidoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.