CAS 117704-87-7
:1-(1-Oxobutyl)-4-piperidinecarboxylic acid
Description:
1-(1-Oxobutyl)-4-piperidinecarboxylic acid, with the CAS number 117704-87-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidic properties, and an oxobutyl substituent that enhances its molecular complexity. The presence of the carbonyl group (ketone) in the oxobutyl chain indicates potential reactivity, particularly in condensation reactions or as a site for nucleophilic attack. The piperidine moiety is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Its solubility profile is likely influenced by the carboxylic acid group, which can engage in hydrogen bonding, enhancing its interaction with polar solvents. Overall, this compound may exhibit unique pharmacological properties, making it a candidate for further research in drug development and synthesis.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-2-3-9(12)11-6-4-8(5-7-11)10(13)14/h8H,2-7H2,1H3,(H,13,14)
InChI key:InChIKey=MTJRPNQAZYWTDD-UHFFFAOYSA-N
SMILES:C(CCC)(=O)N1CCC(C(O)=O)CC1
Synonyms:- 1-(1-Oxobutyl)-4-piperidinecarboxylic acid
- 4-Piperidinecarboxylic acid, 1-(1-oxobutyl)-
- 1-Butanoylpiperidine-4-carboxylic acid
- 1-(1-Oxobutyl)piperidine-4-carboxylic acid
- 1-Butyryl-4-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.